Home
Products
Cucurbitacin IIA
| Product Name | Cucurbitacin IIA |
| Price: | $117 / 20mg |
| Catalog No.: | CN07963 |
| CAS No.: | 58546-34-2 |
| Molecular Formula: | C32H50O8 |
| Molecular Weight: | 562.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Hemsleya amabilis Diels. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC(CCC(=O)C(C1C(O)CC2(C1(C)CC(=O)C1(C2CC=C2C1CC(O)C(C2(C)C)O)C)C)(O)C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cucurbitacin IIa is a triterpene isolated from Hemsleya amalils Diels, induces apoptosis of cancer cells, reduces expression of survivin, reduces phospho-Histone H3 and increases cleaved PARP in cancer cells[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 679.1±55.0 °C at 760 mmHg |
| Flash Point | 209.7±25.0 °C |
| Exact Mass | 562.350586 |
| PSA | 141.36000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |
| Storage condition | -20℃ |